C24H21F2N5O — CID 11568224
3-[5-(3-amino-3-methylbut-1-ynyl)-2-methoxyphenyl]-N-(2,4-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine (PubChem CID 11568224) has the molecular formula C24H21F2N5O and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-[5-(3-amino-3-methylbut-1-ynyl)-2-methoxyphenyl]-N-(2,4-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine.
| Compound Name | 3-[5-(3-amino-3-methylbut-1-ynyl)-2-methoxyphenyl]-N-(2,4-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine |
|---|---|
| PubChem CID | 11568224 |
| Molecular Formula | C24H21F2N5O |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[5-(3-amino-3-methylbut-1-ynyl)-2-methoxyphenyl]-N-(2,4-difluorophenyl)-2H-pyrazolo[3,4-b]pyridin-6-amine |
| SMILES | COc1ccc(C#CC(C)(C)N)cc1-c1[nH]nc2nc(Nc3ccc(F)cc3F)ccc12 |
| InChI | InChI=1S/C24H21F2N5O/c1-24(2,27)11-10-14-4-8-20(32-3)17(12-14)22-16-6-9-21(29-23(16)31-30-22)28-19-7-5-15(25)13-18(19)26/h4-9,12-13H,27H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | XNDSNFANNLNJCB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|