About 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione
5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 11568280) has the molecular formula C18H12BrF2N3O3
and a molecular weight of 436.21 g/mol. Its IUPAC name is 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| PubChem CID | 11568280 |
| Molecular Formula | C18H12BrF2N3O3 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(CN2Cc3cc(F)c(F)cc3C2=O)(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C18H12BrF2N3O3/c19-11-3-1-10(2-4-11)18(16(26)22-17(27)23-18)8-24-7-9-5-13(20)14(21)6-12(9)15(24)25/h1-6H,7-8H2,(H2,22,23,26,27) |
| InChIKey | AFQOZCWSRZWIKG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione?
The IUPAC name of 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (CID 11568280) is 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
What is the SMILES notation for 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione?
The canonical SMILES for 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione is O=C1NC(=O)C(CN2Cc3cc(F)c(F)cc3C2=O)(c2ccc(Br)cc2)N1.
What is the InChIKey of 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione?
The InChIKey is AFQOZCWSRZWIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrF2N3O3/c19-11-3-1-10(2-4-11)18(16(26)22-17(27)23-18)8-24-7-9-5-13(20)14(21)6-12(9)15(24)25/h1-6H,7-8H2,(H2,22,23,26,27).
What are the key properties of 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione?
5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione has a molecular weight of 436.21 g/mol, XLogP of 2.42, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-5-[(5,6-difluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione is sourced from PubChem (CID 11568280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).