C13H12ClN3O — CID 115683291
N-(6-chloro-2-pyridinyl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 115683291) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 115683291 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(Cl)n2)c(C)n1 |
| InChI | InChI=1S/C13H12ClN3O/c1-8-6-7-10(9(2)15-8)13(18)17-12-5-3-4-11(14)16-12/h3-7H,1-2H3,(H,16,17,18) |
| InChIKey | BBPAINMCTFBEMG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|