C17H27NO3 — CID 115683825
[1-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclohexyl]methanol (PubChem CID 115683825) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [1-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 115683825 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [1-[[(2,5-dimethoxyphenyl)methylamino]methyl]cyclohexyl]methanol |
| SMILES | COc1ccc(OC)c(CNCC2(CO)CCCCC2)c1 |
| InChI | InChI=1S/C17H27NO3/c1-20-15-6-7-16(21-2)14(10-15)11-18-12-17(13-19)8-4-3-5-9-17/h6-7,10,18-19H,3-5,8-9,11-13H2,1-2H3 |
| InChIKey | DZFUKAUMCMXZTK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |