2-(2,2-dimethylthiomorpholin-4-yl)acetic acid

C8H15NO2S — CID 115683963

IUPAC2-(2,2-dimethylthiomorpholin-4-yl)acetic acid
SMILESCC1(C)CN(CC(=O)O)CCS1
InChIInChI=1S/C8H15NO2S/c1-8(2)6-9(3-4-12-8)5-7(10)11/h3-6H2,1-2H3,(H,10,11)
InChIKeyRQCCWGPWPCSNIM-UHFFFAOYSA-N
MW189.28 g/mol
LogP0.90
Rot. Bonds2

About 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid

2-(2,2-dimethylthiomorpholin-4-yl)acetic acid (PubChem CID 115683963) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2,2-dimethylthiomorpholin-4-yl)acetic acid
PubChem CID115683963
Molecular FormulaC8H15NO2S
Molecular Weight189.28 g/mol
Exact Mass189.08
IUPAC Name2-(2,2-dimethylthiomorpholin-4-yl)acetic acid
SMILESCC1(C)CN(CC(=O)O)CCS1
InChIInChI=1S/C8H15NO2S/c1-8(2)6-9(3-4-12-8)5-7(10)11/h3-6H2,1-2H3,(H,10,11)
InChIKeyRQCCWGPWPCSNIM-UHFFFAOYSA-N
XLogP0.90
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.28
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid?
The IUPAC name of 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid (CID 115683963) is 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid.
What is the SMILES notation for 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid?
The canonical SMILES for 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid is CC1(C)CN(CC(=O)O)CCS1.
What is the InChIKey of 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid?
The InChIKey is RQCCWGPWPCSNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-8(2)6-9(3-4-12-8)5-7(10)11/h3-6H2,1-2H3,(H,10,11).
What are the key properties of 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid?
2-(2,2-dimethylthiomorpholin-4-yl)acetic acid has a molecular weight of 189.28 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylthiomorpholin-4-yl)acetic acid is sourced from PubChem (CID 115683963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).