C13H12F3NO2S — CID 115684216
N-(3,3,3-trifluoropropyl)naphthalene-1-sulfonamide (PubChem CID 115684216) has the molecular formula C13H12F3NO2S and a molecular weight of 303.31 g/mol. Its IUPAC name is N-(3,3,3-trifluoropropyl)naphthalene-1-sulfonamide.
| Compound Name | N-(3,3,3-trifluoropropyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 115684216 |
| Molecular Formula | C13H12F3NO2S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(3,3,3-trifluoropropyl)naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(NCCC(F)(F)F)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H12F3NO2S/c14-13(15,16)8-9-17-20(18,19)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,17H,8-9H2 |
| InChIKey | ZYGDOANXKZLCHP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |