C8H10Cl2F3N3 — CID 115684458
N-[(2,5-dichloro-3-methylimidazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 115684458) has the molecular formula C8H10Cl2F3N3 and a molecular weight of 276.09 g/mol. Its IUPAC name is N-[(2,5-dichloro-3-methylimidazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(2,5-dichloro-3-methylimidazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 115684458 |
| Molecular Formula | C8H10Cl2F3N3 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-[(2,5-dichloro-3-methylimidazol-4-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | Cn1c(Cl)nc(Cl)c1CNCCC(F)(F)F |
| InChI | InChI=1S/C8H10Cl2F3N3/c1-16-5(6(9)15-7(16)10)4-14-3-2-8(11,12)13/h14H,2-4H2,1H3 |
| InChIKey | JNPQNIKRZSXTHT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|