C14H14N4S2 — CID 115685301
4-(1,4-dithian-2-ylmethylamino)cinnoline-3-carbonitrile (PubChem CID 115685301) has the molecular formula C14H14N4S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 4-(1,4-dithian-2-ylmethylamino)cinnoline-3-carbonitrile.
| Compound Name | 4-(1,4-dithian-2-ylmethylamino)cinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 115685301 |
| Molecular Formula | C14H14N4S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(1,4-dithian-2-ylmethylamino)cinnoline-3-carbonitrile |
| SMILES | N#Cc1nnc2ccccc2c1NCC1CSCCS1 |
| InChI | InChI=1S/C14H14N4S2/c15-7-13-14(16-8-10-9-19-5-6-20-10)11-3-1-2-4-12(11)17-18-13/h1-4,10H,5-6,8-9H2,(H,16,17) |
| InChIKey | CXWNHYYLZWUFHG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |