C14H19N3S — CID 115685594
N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]thian-4-amine (PubChem CID 115685594) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]thian-4-amine.
| Compound Name | N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 115685594 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]thian-4-amine |
| SMILES | Cc1nc2ccccn2c1CNC1CCSCC1 |
| InChI | InChI=1S/C14H19N3S/c1-11-13(10-15-12-5-8-18-9-6-12)17-7-3-2-4-14(17)16-11/h2-4,7,12,15H,5-6,8-10H2,1H3 |
| InChIKey | GFVYTGMJBTUZEC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |