C12H20N2O — CID 115686396
N-[(4-methyloxan-4-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine (PubChem CID 115686396) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is N-[(4-methyloxan-4-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine.
| Compound Name | N-[(4-methyloxan-4-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 115686396 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | N-[(4-methyloxan-4-yl)methyl]-1-(1H-pyrrol-3-yl)methanamine |
| SMILES | CC1(CNCc2cc[nH]c2)CCOCC1 |
| InChI | InChI=1S/C12H20N2O/c1-12(3-6-15-7-4-12)10-14-9-11-2-5-13-8-11/h2,5,8,13-14H,3-4,6-7,9-10H2,1H3 |
| InChIKey | QOVVUACXYGAYJD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |