C15H23FN2O — CID 115686817
N-(2,2-dimethylheptyl)-3-fluoropyridine-4-carboxamide (PubChem CID 115686817) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(2,2-dimethylheptyl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 115686817 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-(2,2-dimethylheptyl)-3-fluoropyridine-4-carboxamide |
| SMILES | CCCCCC(C)(C)CNC(=O)c1ccncc1F |
| InChI | InChI=1S/C15H23FN2O/c1-4-5-6-8-15(2,3)11-18-14(19)12-7-9-17-10-13(12)16/h7,9-10H,4-6,8,11H2,1-3H3,(H,18,19) |
| InChIKey | SQLNSKAUNUDQNG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|