C22H26N6OS2 — CID 11568714
4-methyl-5-[4-methyl-5-[3-(2-methyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole (PubChem CID 11568714) has the molecular formula C22H26N6OS2 and a molecular weight of 454.63 g/mol. Its IUPAC name is 4-methyl-5-[4-methyl-5-[3-(2-methyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole.
| Compound Name | 4-methyl-5-[4-methyl-5-[3-(2-methyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 11568714 |
| Molecular Formula | C22H26N6OS2 |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 4-methyl-5-[4-methyl-5-[3-(2-methyl-5,6,8,9-tetrahydro-[1,3]thiazolo[4,5-h][3]benzazepin-7-yl)propylsulfanyl]-1,2,4-triazol-3-yl]-1,3-oxazole |
| SMILES | Cc1nc2cc3c(cc2s1)CCN(CCCSc1nnc(-c2ocnc2C)n1C)CC3 |
| InChI | InChI=1S/C22H26N6OS2/c1-14-20(29-13-23-14)21-25-26-22(27(21)3)30-10-4-7-28-8-5-16-11-18-19(31-15(2)24-18)12-17(16)6-9-28/h11-13H,4-10H2,1-3H3 |
| InChIKey | GNAFTHDBPJUMAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|