C29H42O4 — CID 11568717
(3S,8S,9S,10R,13S,14S,16R,17S)-16-(2,5-dimethoxyphenyl)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 11568717) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is (3S,8S,9S,10R,13S,14S,16R,17S)-16-(2,5-dimethoxyphenyl)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13S,14S,16R,17S)-16-(2,5-dimethoxyphenyl)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11568717 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | (3S,8S,9S,10R,13S,14S,16R,17S)-16-(2,5-dimethoxyphenyl)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | COc1ccc(OC)c([C@@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]2[C@H](C)O)c1 |
| InChI | InChI=1S/C29H42O4/c1-17(30)27-23(22-15-20(32-4)7-9-26(22)33-5)16-25-21-8-6-18-14-19(31)10-12-28(18,2)24(21)11-13-29(25,27)3/h6-7,9,15,17,19,21,23-25,27,30-31H,8,10-14,16H2,1-5H3/t17-,19-,21+,23-,24-,25-,27-,28-,29-/m0/s1 |
| InChIKey | KADXGKROVVTKIB-UJAROBLZSA-N |
| XLogP | 5.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|