About 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide
3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide (PubChem CID 115687226) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide |
| PubChem CID | 115687226 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide |
| SMILES | CCC1CCN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C9H18N2O/c1-4-8-5-6-11(7-8)9(12)10(2)3/h8H,4-7H2,1-3H3 |
| InChIKey | ZRRRVGBAGOWDCB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide?
The IUPAC name of 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide (CID 115687226) is 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide.
What is the SMILES notation for 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide?
The canonical SMILES for 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide is CCC1CCN(C(=O)N(C)C)C1.
What is the InChIKey of 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide?
The InChIKey is ZRRRVGBAGOWDCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-4-8-5-6-11(7-8)9(12)10(2)3/h8H,4-7H2,1-3H3.
What are the key properties of 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide?
3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide has a molecular weight of 170.26 g/mol, XLogP of 1.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N,N-dimethylpyrrolidine-1-carboxamide is sourced from PubChem (CID 115687226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).