C20H25BrO7 — CID 11568756
(4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-4a,6-dimethyl-3,4-dihydro-2H-xanthen-1-one (PubChem CID 11568756) has the molecular formula C20H25BrO7 and a molecular weight of 457.32 g/mol. Its IUPAC name is (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-4a,6-dimethyl-3,4-dihydro-2H-xanthen-1-one.
| Compound Name | (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-4a,6-dimethyl-3,4-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 11568756 |
| Molecular Formula | C20H25BrO7 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | (4S,4aR)-7-bromo-9-hydroxy-8-methoxy-4-(2-methoxyethoxymethoxy)-4a,6-dimethyl-3,4-dihydro-2H-xanthen-1-one |
| SMILES | COCCOCO[C@H]1CCC(=O)C2=C(O)c3c(cc(C)c(Br)c3OC)O[C@]21C |
| InChI | InChI=1S/C20H25BrO7/c1-11-9-13-15(19(25-4)17(11)21)18(23)16-12(22)5-6-14(20(16,2)28-13)27-10-26-8-7-24-3/h9,14,23H,5-8,10H2,1-4H3/t14-,20-/m0/s1 |
| InChIKey | WSRIKMMVTJCNBF-XOBRGWDASA-N |
| XLogP | 3.55 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|