C14H12ClN3O2S — CID 115687718
3-chloro-4-cyano-N-(2,6-dimethyl-3-pyridinyl)benzenesulfonamide (PubChem CID 115687718) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-(2,6-dimethyl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 3-chloro-4-cyano-N-(2,6-dimethyl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115687718 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 3-chloro-4-cyano-N-(2,6-dimethyl-3-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C#N)c(Cl)c2)c(C)n1 |
| InChI | InChI=1S/C14H12ClN3O2S/c1-9-3-6-14(10(2)17-9)18-21(19,20)12-5-4-11(8-16)13(15)7-12/h3-7,18H,1-2H3 |
| InChIKey | IPTLGTDVTLVILB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |