About 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol (PubChem CID 115688722) has the molecular formula C11H20N2OS
and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol |
| PubChem CID | 115688722 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol |
| SMILES | CCN(CCCO)Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-13(6-5-7-14)8-11-12-9(2)10(3)15-11/h14H,4-8H2,1-3H3 |
| InChIKey | OHCDDMRFKAEFNT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol?
The IUPAC name of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol (CID 115688722) is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol.
What is the SMILES notation for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol?
The canonical SMILES for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol is CCN(CCCO)Cc1nc(C)c(C)s1.
What is the InChIKey of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol?
The InChIKey is OHCDDMRFKAEFNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2OS/c1-4-13(6-5-7-14)8-11-12-9(2)10(3)15-11/h14H,4-8H2,1-3H3.
What are the key properties of 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol?
3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol has a molecular weight of 228.36 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-ethylamino]propan-1-ol is sourced from PubChem (CID 115688722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).