C10H22N2O — CID 115688949
2-N,2-N-dimethyl-1-N-(oxolan-3-yl)butane-1,2-diamine (PubChem CID 115688949) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-(oxolan-3-yl)butane-1,2-diamine.
| Compound Name | 2-N,2-N-dimethyl-1-N-(oxolan-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 115688949 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-(oxolan-3-yl)butane-1,2-diamine |
| SMILES | CCC(CNC1CCOC1)N(C)C |
| InChI | InChI=1S/C10H22N2O/c1-4-10(12(2)3)7-11-9-5-6-13-8-9/h9-11H,4-8H2,1-3H3 |
| InChIKey | DFOHRDSTKYQCES-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |