About N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine
N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine (PubChem CID 115689262) has the molecular formula C12H20N4
and a molecular weight of 220.32 g/mol. Its IUPAC name is N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine.
Molecular Properties
| Compound Name | N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine |
| PubChem CID | 115689262 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine |
| SMILES | CC1CCCC1NCc1nncn1C1CC1 |
| InChI | InChI=1S/C12H20N4/c1-9-3-2-4-11(9)13-7-12-15-14-8-16(12)10-5-6-10/h8-11,13H,2-7H2,1H3 |
| InChIKey | FOOKZAJEMWYAKV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine?
The IUPAC name of N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine (CID 115689262) is N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine.
What is the SMILES notation for N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine?
The canonical SMILES for N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine is CC1CCCC1NCc1nncn1C1CC1.
What is the InChIKey of N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine?
The InChIKey is FOOKZAJEMWYAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4/c1-9-3-2-4-11(9)13-7-12-15-14-8-16(12)10-5-6-10/h8-11,13H,2-7H2,1H3.
What are the key properties of N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine?
N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine has a molecular weight of 220.32 g/mol, XLogP of 1.89, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-cyclopropyl-1,2,4-triazol-3-yl)methyl]-2-methylcyclopentan-1-amine is sourced from PubChem (CID 115689262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).