C22H25F3N4O2S — CID 11568937
2-methyl-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-1,5-dihydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 11568937) has the molecular formula C22H25F3N4O2S and a molecular weight of 466.53 g/mol. Its IUPAC name is 2-methyl-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-1,5-dihydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-1,5-dihydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11568937 |
| Molecular Formula | C22H25F3N4O2S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-methyl-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-1,5-dihydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)C2=C(C)NC3=CC=CCN32)cc1C(F)(F)F |
| InChI | InChI=1S/C22H25F3N4O2S/c1-3-4-7-12-31-17-10-9-15(13-16(17)22(23,24)25)27-21(32)28-20(30)19-14(2)26-18-8-5-6-11-29(18)19/h5-6,8-10,13,26H,3-4,7,11-12H2,1-2H3,(H2,27,28,30,32) |
| InChIKey | VGJJFMJUWKOIRM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|