C13H18N6O — CID 115690608
N-ethyl-6-(3-pyrazol-1-ylpropylamino)pyridazine-3-carboxamide (PubChem CID 115690608) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is N-ethyl-6-(3-pyrazol-1-ylpropylamino)pyridazine-3-carboxamide.
| Compound Name | N-ethyl-6-(3-pyrazol-1-ylpropylamino)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 115690608 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-ethyl-6-(3-pyrazol-1-ylpropylamino)pyridazine-3-carboxamide |
| SMILES | CCNC(=O)c1ccc(NCCCn2cccn2)nn1 |
| InChI | InChI=1S/C13H18N6O/c1-2-14-13(20)11-5-6-12(18-17-11)15-7-3-9-19-10-4-8-16-19/h4-6,8,10H,2-3,7,9H2,1H3,(H,14,20)(H,15,18) |
| InChIKey | KKCUXJFVTYEASR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|