C15H20N2O2 — CID 115691704
N-(3-hydroxybutyl)-N,2-dimethyl-1H-indole-3-carboxamide (PubChem CID 115691704) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N,2-dimethyl-1H-indole-3-carboxamide.
| Compound Name | N-(3-hydroxybutyl)-N,2-dimethyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 115691704 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-(3-hydroxybutyl)-N,2-dimethyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)N(C)CCC(C)O |
| InChI | InChI=1S/C15H20N2O2/c1-10(18)8-9-17(3)15(19)14-11(2)16-13-7-5-4-6-12(13)14/h4-7,10,16,18H,8-9H2,1-3H3 |
| InChIKey | RECBYJIVSGQCEO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |