C19H24F3N3O6S — CID 11569185
(5S)-5-methyl-5-[[4-[4-(3,3,3-trifluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 11569185) has the molecular formula C19H24F3N3O6S and a molecular weight of 479.48 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-[4-(3,3,3-trifluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-[4-(3,3,3-trifluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11569185 |
| Molecular Formula | C19H24F3N3O6S |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (5S)-5-methyl-5-[[4-[4-(3,3,3-trifluoropropoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3ccc(OCCC(F)(F)F)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H24F3N3O6S/c1-18(16(26)23-17(27)24-18)12-32(28,29)25-9-6-15(7-10-25)31-14-4-2-13(3-5-14)30-11-8-19(20,21)22/h2-5,15H,6-12H2,1H3,(H2,23,24,26,27)/t18-/m1/s1 |
| InChIKey | ZVFKJDDERIYYSN-GOSISDBHSA-N |
| XLogP | 1.79 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|