About 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile
4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile (PubChem CID 115692016) has the molecular formula C11H10F2N2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile |
| PubChem CID | 115692016 |
| Molecular Formula | C11H10F2N2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile |
| SMILES | C=CC(C)Nc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C11H10F2N2/c1-3-7(2)15-11-9(12)4-8(6-14)5-10(11)13/h3-5,7,15H,1H2,2H3 |
| InChIKey | LKRKQCTYKXHNGW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile?
The IUPAC name of 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile (CID 115692016) is 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile?
The canonical SMILES for 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile is C=CC(C)Nc1c(F)cc(C#N)cc1F.
What is the InChIKey of 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile?
The InChIKey is LKRKQCTYKXHNGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2/c1-3-7(2)15-11-9(12)4-8(6-14)5-10(11)13/h3-5,7,15H,1H2,2H3.
What are the key properties of 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile?
4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile has a molecular weight of 208.21 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(but-3-en-2-ylamino)-3,5-difluorobenzonitrile is sourced from PubChem (CID 115692016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).