C32H23FN4 — CID 11569244
[3-[7-fluoro-3-methyl-6-[4-(2-quinolin-6-ylethynyl)phenyl]indazol-1-yl]phenyl]methanamine (PubChem CID 11569244) has the molecular formula C32H23FN4 and a molecular weight of 482.56 g/mol. Its IUPAC name is [3-[7-fluoro-3-methyl-6-[4-(2-quinolin-6-ylethynyl)phenyl]indazol-1-yl]phenyl]methanamine.
| Compound Name | [3-[7-fluoro-3-methyl-6-[4-(2-quinolin-6-ylethynyl)phenyl]indazol-1-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 11569244 |
| Molecular Formula | C32H23FN4 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | [3-[7-fluoro-3-methyl-6-[4-(2-quinolin-6-ylethynyl)phenyl]indazol-1-yl]phenyl]methanamine |
| SMILES | Cc1nn(-c2cccc(CN)c2)c2c(F)c(-c3ccc(C#Cc4ccc5ncccc5c4)cc3)ccc12 |
| InChI | InChI=1S/C32H23FN4/c1-21-28-14-15-29(31(33)32(28)37(36-21)27-6-2-4-24(19-27)20-34)25-12-9-22(10-13-25)7-8-23-11-16-30-26(18-23)5-3-17-35-30/h2-6,9-19H,20,34H2,1H3 |
| InChIKey | FXWZSIQGOAOVMF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|