C11H13N3S — CID 115692578
N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine (PubChem CID 115692578) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 115692578 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]pyridin-2-amine |
| SMILES | Cc1nc(C)c(CNc2ccccn2)s1 |
| InChI | InChI=1S/C11H13N3S/c1-8-10(15-9(2)14-8)7-13-11-5-3-4-6-12-11/h3-6H,7H2,1-2H3,(H,12,13) |
| InChIKey | JZBNUAFENJIRNU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |