About 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide
3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide (PubChem CID 11569310) has the molecular formula C29H27NO6
and a molecular weight of 485.54 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide |
| PubChem CID | 11569310 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide |
| SMILES | CCOC(=O)C1=C(c2ccc3c(c2)OCO3)c2ccc(OCCCc3ccccc3)cc2/C1=[N+](/C)[O-] |
| InChI | InChI=1S/C29H27NO6/c1-3-33-29(31)27-26(20-11-14-24-25(16-20)36-18-35-24)22-13-12-21(17-23(22)28(27)30(2)32)34-15-7-10-19-8-5-4-6-9-19/h4-6,8-9,11-14,16-17H,3,7,10,15,18H2,1-2H3/b30-28+ |
| InChIKey | RLCGQWZKSYOBHP-SJCQXOIGSA-N |
| XLogP | 4.73 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide (CID 11569310) is 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide is CCOC(=O)C1=C(c2ccc3c(c2)OCO3)c2ccc(OCCCc3ccccc3)cc2/C1=[N+](/C)[O-].
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide?
The InChIKey is RLCGQWZKSYOBHP-SJCQXOIGSA-N. The full InChI is InChI=1S/C29H27NO6/c1-3-33-29(31)27-26(20-11-14-24-25(16-20)36-18-35-24)22-13-12-21(17-23(22)28(27)30(2)32)34-15-7-10-19-8-5-4-6-9-19/h4-6,8-9,11-14,16-17H,3,7,10,15,18H2,1-2H3/b30-28+.
What are the key properties of 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide?
3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide has a molecular weight of 485.54 g/mol, XLogP of 4.73, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-2-ethoxycarbonyl-N-methyl-6-(3-phenylpropoxy)inden-1-imine oxide is sourced from PubChem (CID 11569310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).