C11H15ClN4 — CID 115693281
N-[(4-chloro-1-methylpyrrol-2-yl)methyl]-1-(2-methylpyrazol-3-yl)methanamine (PubChem CID 115693281) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is N-[(4-chloro-1-methylpyrrol-2-yl)methyl]-1-(2-methylpyrazol-3-yl)methanamine.
| Compound Name | N-[(4-chloro-1-methylpyrrol-2-yl)methyl]-1-(2-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 115693281 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-[(4-chloro-1-methylpyrrol-2-yl)methyl]-1-(2-methylpyrazol-3-yl)methanamine |
| SMILES | Cn1cc(Cl)cc1CNCc1ccnn1C |
| InChI | InChI=1S/C11H15ClN4/c1-15-8-9(12)5-11(15)7-13-6-10-3-4-14-16(10)2/h3-5,8,13H,6-7H2,1-2H3 |
| InChIKey | ZNUVGJFLXTVXRU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |