About N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine
N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 115695621) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine |
| PubChem CID | 115695621 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NC2CC=CC2)sc1C |
| InChI | InChI=1S/C10H14N2S/c1-7-8(2)13-10(11-7)12-9-5-3-4-6-9/h3-4,9H,5-6H2,1-2H3,(H,11,12) |
| InChIKey | NXEFUAALAPBWPL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine?
The IUPAC name of N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine (CID 115695621) is N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine?
The canonical SMILES for N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine is Cc1nc(NC2CC=CC2)sc1C.
What is the InChIKey of N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine?
The InChIKey is NXEFUAALAPBWPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-7-8(2)13-10(11-7)12-9-5-3-4-6-9/h3-4,9H,5-6H2,1-2H3,(H,11,12).
What are the key properties of N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine?
N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine has a molecular weight of 194.30 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopent-3-en-1-yl-4,5-dimethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 115695621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).