C26H28F2N4O2S — CID 11569575
3-[5-[3-[2-(difluoromethoxy)ethoxy]prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole (PubChem CID 11569575) has the molecular formula C26H28F2N4O2S and a molecular weight of 498.60 g/mol. Its IUPAC name is 3-[5-[3-[2-(difluoromethoxy)ethoxy]prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole.
| Compound Name | 3-[5-[3-[2-(difluoromethoxy)ethoxy]prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
|---|---|
| PubChem CID | 11569575 |
| Molecular Formula | C26H28F2N4O2S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-[5-[3-[2-(difluoromethoxy)ethoxy]prop-1-ynyl]thiophen-3-yl]-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
| SMILES | CN1CCN(Cc2ccc3c(c2)Cc2c(-c4csc(C#CCOCCOC(F)F)c4)n[nH]c2-3)CC1 |
| InChI | InChI=1S/C26H28F2N4O2S/c1-31-6-8-32(9-7-31)16-18-4-5-22-19(13-18)15-23-24(29-30-25(22)23)20-14-21(35-17-20)3-2-10-33-11-12-34-26(27)28/h4-5,13-14,17,26H,6-12,15-16H2,1H3,(H,29,30) |
| InChIKey | MHOOSKDVAUPJMS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|