C28H28F3NO4 — CID 11569584
4-[4-(4-hydroxybutoxy)-3-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]phenyl]benzoic acid (PubChem CID 11569584) has the molecular formula C28H28F3NO4 and a molecular weight of 499.53 g/mol. Its IUPAC name is 4-[4-(4-hydroxybutoxy)-3-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-(4-hydroxybutoxy)-3-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11569584 |
| Molecular Formula | C28H28F3NO4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 4-[4-(4-hydroxybutoxy)-3-[4-pyrrolidin-1-yl-3-(trifluoromethyl)phenyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(OCCCCO)c(-c3ccc(N4CCCC4)c(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C28H28F3NO4/c29-28(30,31)24-18-22(9-11-25(24)32-13-1-2-14-32)23-17-21(10-12-26(23)36-16-4-3-15-33)19-5-7-20(8-6-19)27(34)35/h5-12,17-18,33H,1-4,13-16H2,(H,34,35) |
| InChIKey | FCKTUZDSGYGGDB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|