C15H13ClFNO2 — CID 115695848
N-[(3-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 115695848) has the molecular formula C15H13ClFNO2 and a molecular weight of 293.72 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 115695848 |
| Molecular Formula | C15H13ClFNO2 |
| Molecular Weight | 293.72 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Fc1c(Cl)cccc1CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H13ClFNO2/c16-12-3-1-2-10(15(12)17)9-18-11-4-5-13-14(8-11)20-7-6-19-13/h1-5,8,18H,6-7,9H2 |
| InChIKey | HWQJYFASVUQMBD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|