3-amino-5-bromobenzoic acid

C7H6BrNO2 — CID 11569604

IUPAC3-amino-5-bromobenzoic acid
SMILESNc1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C7H6BrNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H,10,11)
InChIKeyRQSXRGSPGHZKFT-UHFFFAOYSA-N
MW216.03 g/mol
LogP1.73
Rot. Bonds1

About 3-amino-5-bromobenzoic acid

3-amino-5-bromobenzoic acid (PubChem CID 11569604) has the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. Its IUPAC name is 3-amino-5-bromobenzoic acid.

Molecular Properties

Compound Name3-amino-5-bromobenzoic acid
PubChem CID11569604
Molecular FormulaC7H6BrNO2
Molecular Weight216.03 g/mol
Exact Mass214.96
IUPAC Name3-amino-5-bromobenzoic acid
SMILESNc1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C7H6BrNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H,10,11)
InChIKeyRQSXRGSPGHZKFT-UHFFFAOYSA-N
XLogP1.73
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.03
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 3-amino-5-bromobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-5-bromobenzoic acid?
The IUPAC name of 3-amino-5-bromobenzoic acid (CID 11569604) is 3-amino-5-bromobenzoic acid.
What is the SMILES notation for 3-amino-5-bromobenzoic acid?
The canonical SMILES for 3-amino-5-bromobenzoic acid is Nc1cc(Br)cc(C(=O)O)c1.
What is the InChIKey of 3-amino-5-bromobenzoic acid?
The InChIKey is RQSXRGSPGHZKFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,9H2,(H,10,11).
What are the key properties of 3-amino-5-bromobenzoic acid?
3-amino-5-bromobenzoic acid has a molecular weight of 216.03 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-bromobenzoic acid is sourced from PubChem (CID 11569604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).