C25H29ClFN5O3 — CID 11569627
4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-[2-(2-fluorophenoxy)ethoxy]-1,3,5-triazine-2,4-diamine (PubChem CID 11569627) has the molecular formula C25H29ClFN5O3 and a molecular weight of 501.99 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-[2-(2-fluorophenoxy)ethoxy]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-[2-(2-fluorophenoxy)ethoxy]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 11569627 |
| Molecular Formula | C25H29ClFN5O3 |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 4-N-(3-chloro-4-methoxyphenyl)-2-N-cycloheptyl-6-[2-(2-fluorophenoxy)ethoxy]-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc(OCCOc3ccccc3F)n2)cc1Cl |
| InChI | InChI=1S/C25H29ClFN5O3/c1-33-21-13-12-18(16-19(21)26)29-24-30-23(28-17-8-4-2-3-5-9-17)31-25(32-24)35-15-14-34-22-11-7-6-10-20(22)27/h6-7,10-13,16-17H,2-5,8-9,14-15H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | WQRFEUJKIIKLFU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|