C13H17N3 — CID 115696433
4-[(cyclopent-3-en-1-ylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 115696433) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-[(cyclopent-3-en-1-ylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(cyclopent-3-en-1-ylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 115696433 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-[(cyclopent-3-en-1-ylamino)methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(CNC2CC=CC2)cc(C#N)n1C |
| InChI | InChI=1S/C13H17N3/c1-10-11(7-13(8-14)16(10)2)9-15-12-5-3-4-6-12/h3-4,7,12,15H,5-6,9H2,1-2H3 |
| InChIKey | NWVWBFSXAPCFLF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|