About 3-hexylpyrimidin-4-one
3-hexylpyrimidin-4-one (PubChem CID 115696867) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-hexylpyrimidin-4-one.
Molecular Properties
| Compound Name | 3-hexylpyrimidin-4-one |
| PubChem CID | 115696867 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-hexylpyrimidin-4-one |
| SMILES | CCCCCCn1cnccc1=O |
| InChI | InChI=1S/C10H16N2O/c1-2-3-4-5-8-12-9-11-7-6-10(12)13/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | CMZKJVXKTXZSSN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexylpyrimidin-4-one?
The IUPAC name of 3-hexylpyrimidin-4-one (CID 115696867) is 3-hexylpyrimidin-4-one.
What is the SMILES notation for 3-hexylpyrimidin-4-one?
The canonical SMILES for 3-hexylpyrimidin-4-one is CCCCCCn1cnccc1=O.
What is the InChIKey of 3-hexylpyrimidin-4-one?
The InChIKey is CMZKJVXKTXZSSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-3-4-5-8-12-9-11-7-6-10(12)13/h6-7,9H,2-5,8H2,1H3.
What are the key properties of 3-hexylpyrimidin-4-one?
3-hexylpyrimidin-4-one has a molecular weight of 180.25 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexylpyrimidin-4-one is sourced from PubChem (CID 115696867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).