About 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol
3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol (PubChem CID 115697275) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol |
| PubChem CID | 115697275 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol |
| SMILES | OCCCNCc1cnc(C2CCC2)s1 |
| InChI | InChI=1S/C11H18N2OS/c14-6-2-5-12-7-10-8-13-11(15-10)9-3-1-4-9/h8-9,12,14H,1-7H2 |
| InChIKey | FTPJJMKLCRFHAV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol?
The IUPAC name of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol (CID 115697275) is 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol.
What is the SMILES notation for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol?
The canonical SMILES for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol is OCCCNCc1cnc(C2CCC2)s1.
What is the InChIKey of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol?
The InChIKey is FTPJJMKLCRFHAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c14-6-2-5-12-7-10-8-13-11(15-10)9-3-1-4-9/h8-9,12,14H,1-7H2.
What are the key properties of 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol?
3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol has a molecular weight of 226.34 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol is sourced from PubChem (CID 115697275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).