C11H18N2OS — CID 115697275
3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol (PubChem CID 115697275) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 115697275 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-[(2-cyclobutyl-1,3-thiazol-5-yl)methylamino]propan-1-ol |
| SMILES | OCCCNCc1cnc(C2CCC2)s1 |
| InChI | InChI=1S/C11H18N2OS/c14-6-2-5-12-7-10-8-13-11(15-10)9-3-1-4-9/h8-9,12,14H,1-7H2 |
| InChIKey | FTPJJMKLCRFHAV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|