C30H24N6O3 — CID 11569849
N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]-2,2-diphenylacetamide (PubChem CID 11569849) has the molecular formula C30H24N6O3 and a molecular weight of 516.56 g/mol. Its IUPAC name is N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]-2,2-diphenylacetamide.
| Compound Name | N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 11569849 |
| Molecular Formula | C30H24N6O3 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-[6-amino-2-(4-methoxyphenyl)-1-oxo-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(-n2nc3c(NC(=O)C(c4ccccc4)c4ccccc4)nc4c(N)cccc4n3c2=O)cc1 |
| InChI | InChI=1S/C30H24N6O3/c1-39-22-17-15-21(16-18-22)36-30(38)35-24-14-8-13-23(31)26(24)32-27(28(35)34-36)33-29(37)25(19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-18,25H,31H2,1H3,(H,32,33,37) |
| InChIKey | CLKIIDANGTWZHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|