C12H18N2S2 — CID 115698941
N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine (PubChem CID 115698941) has the molecular formula C12H18N2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine.
| Compound Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine |
|---|---|
| PubChem CID | 115698941 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-2-prop-2-enylsulfanylethanamine |
| SMILES | C=CCSCCNCc1cnc(C2CC2)s1 |
| InChI | InChI=1S/C12H18N2S2/c1-2-6-15-7-5-13-8-11-9-14-12(16-11)10-3-4-10/h2,9-10,13H,1,3-8H2 |
| InChIKey | UGNOTEURGPJRLK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|