C10H13F3N2S — CID 115699018
N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 115699018) has the molecular formula C10H13F3N2S and a molecular weight of 250.29 g/mol. Its IUPAC name is N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 115699018 |
| Molecular Formula | C10H13F3N2S |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-[(2-cyclopropyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | FC(F)(F)CCNCc1cnc(C2CC2)s1 |
| InChI | InChI=1S/C10H13F3N2S/c11-10(12,13)3-4-14-5-8-6-15-9(16-8)7-1-2-7/h6-7,14H,1-5H2 |
| InChIKey | CLUOAFYCOICVFD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|