C13H17N5O2 — CID 115699548
7-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 115699548) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 7-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 7-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 115699548 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 7-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | C=C(C)COCCNC(=O)c1nc2nccc(C)n2n1 |
| InChI | InChI=1S/C13H17N5O2/c1-9(2)8-20-7-6-14-12(19)11-16-13-15-5-4-10(3)18(13)17-11/h4-5H,1,6-8H2,2-3H3,(H,14,19) |
| InChIKey | IKVOCVLUPQTYRJ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|