C14H18Cl2N2O2 — CID 115701162
2,6-dichloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-4-carboxamide (PubChem CID 115701162) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 2,6-dichloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115701162 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2,6-dichloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC1(CO)CCCCC1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c15-11-6-10(7-12(16)18-11)13(20)17-8-14(9-19)4-2-1-3-5-14/h6-7,19H,1-5,8-9H2,(H,17,20) |
| InChIKey | WMOODPMBGSFVCG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|