C16H22FNO2 — CID 115701270
4-fluoro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]-3-methylbenzamide (PubChem CID 115701270) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is 4-fluoro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]-3-methylbenzamide.
| Compound Name | 4-fluoro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 115701270 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 4-fluoro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC2(CO)CCCCC2)ccc1F |
| InChI | InChI=1S/C16H22FNO2/c1-12-9-13(5-6-14(12)17)15(20)18-10-16(11-19)7-3-2-4-8-16/h5-6,9,19H,2-4,7-8,10-11H2,1H3,(H,18,20) |
| InChIKey | GRFFNJLJMGQMIV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |