C29H33BrN2O4 — CID 11570306
[1-[3-(3-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide (PubChem CID 11570306) has the molecular formula C29H33BrN2O4 and a molecular weight of 553.50 g/mol. Its IUPAC name is [1-[3-(3-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide.
| Compound Name | [1-[3-(3-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
|---|---|
| PubChem CID | 11570306 |
| Molecular Formula | C29H33BrN2O4 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | [1-[3-(3-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-4-yl]-diphenylmethanol bromide |
| SMILES | O=[N+]([O-])c1cccc(OCCC[N+]23CCC(C(O)(c4ccccc4)c4ccccc4)(CC2)CC3)c1.[Br-] |
| InChI | InChI=1S/C29H33N2O4.BrH/c32-29(24-9-3-1-4-10-24,25-11-5-2-6-12-25)28-15-19-31(20-16-28,21-17-28)18-8-22-35-27-14-7-13-26(23-27)30(33)34;/h1-7,9-14,23,32H,8,15-22H2;1H/q+1;/p-1 |
| InChIKey | XIDWOLDYKKJTMX-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|