C30H32N2O10 — CID 11570566
[(2R,3R,4S,5R)-2,3-diacetyloxy-5-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-4-yl] acetate (PubChem CID 11570566) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3-diacetyloxy-5-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-2,3-diacetyloxy-5-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11570566 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3-diacetyloxy-5-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[(E)-2-phenylethenyl]azetidin-1-yl]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC[C@@H](N2C(=O)C(NC(=O)COc3ccccc3)C2/C=C/c2ccccc2)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H32N2O10/c1-18(33)40-27-24(16-39-30(42-20(3)35)28(27)41-19(2)34)32-23(15-14-21-10-6-4-7-11-21)26(29(32)37)31-25(36)17-38-22-12-8-5-9-13-22/h4-15,23-24,26-28,30H,16-17H2,1-3H3,(H,31,36)/b15-14+/t23?,24-,26?,27+,28-,30-/m1/s1 |
| InChIKey | YETVWGAJXMNZCM-PSDWWDHLSA-N |
| XLogP | 1.63 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|