C15H23NO — CID 115706038
2-[(2-ethylcyclopentyl)amino]-1-phenylethanol (PubChem CID 115706038) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is 2-[(2-ethylcyclopentyl)amino]-1-phenylethanol.
| Compound Name | 2-[(2-ethylcyclopentyl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 115706038 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-[(2-ethylcyclopentyl)amino]-1-phenylethanol |
| SMILES | CCC1CCCC1NCC(O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO/c1-2-12-9-6-10-14(12)16-11-15(17)13-7-4-3-5-8-13/h3-5,7-8,12,14-17H,2,6,9-11H2,1H3 |
| InChIKey | BEVBIRWKOWQFPZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |