C10H20F2N2S — CID 115706186
1-(2,2-difluoroethyl)-N-(2-methylsulfanylethyl)piperidin-4-amine (PubChem CID 115706186) has the molecular formula C10H20F2N2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-(2-methylsulfanylethyl)piperidin-4-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-(2-methylsulfanylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115706186 |
| Molecular Formula | C10H20F2N2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-(2-methylsulfanylethyl)piperidin-4-amine |
| SMILES | CSCCNC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C10H20F2N2S/c1-15-7-4-13-9-2-5-14(6-3-9)8-10(11)12/h9-10,13H,2-8H2,1H3 |
| InChIKey | WPMMPWYFZHAXSP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|