C11H21NO2S — CID 115707649
N-hept-6-en-3-yl-1,1-dioxothiolan-3-amine (PubChem CID 115707649) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N-hept-6-en-3-yl-1,1-dioxothiolan-3-amine.
| Compound Name | N-hept-6-en-3-yl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 115707649 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-hept-6-en-3-yl-1,1-dioxothiolan-3-amine |
| SMILES | C=CCCC(CC)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H21NO2S/c1-3-5-6-10(4-2)12-11-7-8-15(13,14)9-11/h3,10-12H,1,4-9H2,2H3 |
| InChIKey | XMSLLKQJENGKFN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|