C33H40F2N4O5S — CID 11571124
8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 11571124) has the molecular formula C33H40F2N4O5S and a molecular weight of 642.77 g/mol. Its IUPAC name is 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 11571124 |
| Molecular Formula | C33H40F2N4O5S |
| Molecular Weight | 642.77 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 8-[[(3S,4S)-1-(4,4-difluorocyclohexanecarbonyl)-4-phenylpyrrolidin-3-yl]methyl]-3-[(4-methylsulfonylphenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(CN2C(=O)NC3(CCN(C[C@H]4CN(C(=O)C5CCC(F)(F)CC5)C[C@@H]4c4ccccc4)CC3)C2=O)cc1 |
| InChI | InChI=1S/C33H40F2N4O5S/c1-45(43,44)27-9-7-23(8-10-27)19-39-30(41)32(36-31(39)42)15-17-37(18-16-32)20-26-21-38(22-28(26)24-5-3-2-4-6-24)29(40)25-11-13-33(34,35)14-12-25/h2-10,25-26,28H,11-22H2,1H3,(H,36,42)/t26-,28+/m0/s1 |
| InChIKey | CAIVBKJBVBARDA-XTEPFMGCSA-N |
| XLogP | 4.04 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|