About 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol
3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol (PubChem CID 115712199) has the molecular formula C11H22F2N2O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol |
| PubChem CID | 115712199 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol |
| SMILES | CC(CO)CNC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C11H22F2N2O/c1-9(8-16)6-14-10-2-4-15(5-3-10)7-11(12)13/h9-11,14,16H,2-8H2,1H3 |
| InChIKey | JZHVAMCQZLKIOF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol?
The IUPAC name of 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol (CID 115712199) is 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol.
What is the SMILES notation for 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol?
The canonical SMILES for 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol is CC(CO)CNC1CCN(CC(F)F)CC1.
What is the InChIKey of 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol?
The InChIKey is JZHVAMCQZLKIOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2O/c1-9(8-16)6-14-10-2-4-15(5-3-10)7-11(12)13/h9-11,14,16H,2-8H2,1H3.
What are the key properties of 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol?
3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol has a molecular weight of 236.31 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[1-(2,2-difluoroethyl)piperidin-4-yl]amino]-2-methylpropan-1-ol is sourced from PubChem (CID 115712199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).